C13H17ClN2O6S — CID 3985158
[2-[2-chloro-5-(dimethylsulfamoyl)anilino]-2-oxoethyl] 2-methoxyacetate (PubChem CID 3985158) has the molecular formula C13H17ClN2O6S and a molecular weight of 364.81 g/mol. Its IUPAC name is [2-[2-chloro-5-(dimethylsulfamoyl)anilino]-2-oxoethyl] 2-methoxyacetate.
| Compound Name | [2-[2-chloro-5-(dimethylsulfamoyl)anilino]-2-oxoethyl] 2-methoxyacetate |
|---|---|
| PubChem CID | 3985158 |
| Molecular Formula | C13H17ClN2O6S |
| Molecular Weight | 364.81 g/mol |
| Exact Mass | 364.05 |
| IUPAC Name | [2-[2-chloro-5-(dimethylsulfamoyl)anilino]-2-oxoethyl] 2-methoxyacetate |
| SMILES | COCC(=O)OCC(=O)Nc1cc(S(=O)(=O)N(C)C)ccc1Cl |
| InChI | InChI=1S/C13H17ClN2O6S/c1-16(2)23(19,20)9-4-5-10(14)11(6-9)15-12(17)7-22-13(18)8-21-3/h4-6H,7-8H2,1-3H3,(H,15,17) |
| InChIKey | WGIRYBOXAAUVMD-UHFFFAOYSA-N |
| XLogP | 0.72 |
| TPSA | 102.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.81 |
| LogP ≤ 5 | 0.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |