C14H23ClN3O3S+ — CID 8904455
tert-butyl-[2-[2-chloro-5-(dimethylsulfamoyl)anilino]-2-oxoethyl]azanium (PubChem CID 8904455) has the molecular formula C14H23ClN3O3S+ and a molecular weight of 348.88 g/mol. Its IUPAC name is tert-butyl-[2-[2-chloro-5-(dimethylsulfamoyl)anilino]-2-oxoethyl]azanium.
| Compound Name | tert-butyl-[2-[2-chloro-5-(dimethylsulfamoyl)anilino]-2-oxoethyl]azanium |
|---|---|
| PubChem CID | 8904455 |
| Molecular Formula | C14H23ClN3O3S+ |
| Molecular Weight | 348.88 g/mol |
| Exact Mass | 348.11 |
| IUPAC Name | tert-butyl-[2-[2-chloro-5-(dimethylsulfamoyl)anilino]-2-oxoethyl]azanium |
| SMILES | CN(C)S(=O)(=O)c1ccc(Cl)c(NC(=O)C[NH2+]C(C)(C)C)c1 |
| InChI | InChI=1S/C14H22ClN3O3S/c1-14(2,3)16-9-13(19)17-12-8-10(6-7-11(12)15)22(20,21)18(4)5/h6-8,16H,9H2,1-5H3,(H,17,19)/p+1 |
| InChIKey | JBDUFZDZYOXYGW-UHFFFAOYSA-O |
| XLogP | 0.89 |
| TPSA | 83.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.88 |
| LogP ≤ 5 | 0.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |