C16H25ClN3O3S+ — CID 7434668
N-[2-chloro-5-(dimethylsulfamoyl)phenyl]-2-(4-methylpiperidin-1-ium-1-yl)acetamide (PubChem CID 7434668) has the molecular formula C16H25ClN3O3S+ and a molecular weight of 374.91 g/mol. Its IUPAC name is N-[2-chloro-5-(dimethylsulfamoyl)phenyl]-2-(4-methylpiperidin-1-ium-1-yl)acetamide.
| Compound Name | N-[2-chloro-5-(dimethylsulfamoyl)phenyl]-2-(4-methylpiperidin-1-ium-1-yl)acetamide |
|---|---|
| PubChem CID | 7434668 |
| Molecular Formula | C16H25ClN3O3S+ |
| Molecular Weight | 374.91 g/mol |
| Exact Mass | 374.13 |
| IUPAC Name | N-[2-chloro-5-(dimethylsulfamoyl)phenyl]-2-(4-methylpiperidin-1-ium-1-yl)acetamide |
| SMILES | CC1CC[NH+](CC(=O)Nc2cc(S(=O)(=O)N(C)C)ccc2Cl)CC1 |
| InChI | InChI=1S/C16H24ClN3O3S/c1-12-6-8-20(9-7-12)11-16(21)18-15-10-13(4-5-14(15)17)24(22,23)19(2)3/h4-5,10,12H,6-9,11H2,1-3H3,(H,18,21)/p+1 |
| InChIKey | HBVVAPUWPHHMDW-UHFFFAOYSA-O |
| XLogP | 0.84 |
| TPSA | 70.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.91 |
| LogP ≤ 5 | 0.84 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |