C17H24ClN3O5S — CID 8742574
methyl 1-[2-[2-chloro-5-(dimethylsulfamoyl)anilino]-2-oxoethyl]piperidine-4-carboxylate (PubChem CID 8742574) has the molecular formula C17H24ClN3O5S and a molecular weight of 417.92 g/mol. Its IUPAC name is methyl 1-[2-[2-chloro-5-(dimethylsulfamoyl)anilino]-2-oxoethyl]piperidine-4-carboxylate.
| Compound Name | methyl 1-[2-[2-chloro-5-(dimethylsulfamoyl)anilino]-2-oxoethyl]piperidine-4-carboxylate |
|---|---|
| PubChem CID | 8742574 |
| Molecular Formula | C17H24ClN3O5S |
| Molecular Weight | 417.92 g/mol |
| Exact Mass | 417.11 |
| IUPAC Name | methyl 1-[2-[2-chloro-5-(dimethylsulfamoyl)anilino]-2-oxoethyl]piperidine-4-carboxylate |
| SMILES | COC(=O)C1CCN(CC(=O)Nc2cc(S(=O)(=O)N(C)C)ccc2Cl)CC1 |
| InChI | InChI=1S/C17H24ClN3O5S/c1-20(2)27(24,25)13-4-5-14(18)15(10-13)19-16(22)11-21-8-6-12(7-9-21)17(23)26-3/h4-5,10,12H,6-9,11H2,1-3H3,(H,19,22) |
| InChIKey | PESMSXVBWDRBAF-UHFFFAOYSA-N |
| XLogP | 1.41 |
| TPSA | 96.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.92 |
| LogP ≤ 5 | 1.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |