C22H29ClN4O3S — CID 16618242
2-(4-benzyl-1,4-diazepan-1-yl)-N-[2-chloro-5-(dimethylsulfamoyl)phenyl]acetamide (PubChem CID 16618242) has the molecular formula C22H29ClN4O3S and a molecular weight of 465.02 g/mol. Its IUPAC name is 2-(4-benzyl-1,4-diazepan-1-yl)-N-[2-chloro-5-(dimethylsulfamoyl)phenyl]acetamide.
| Compound Name | 2-(4-benzyl-1,4-diazepan-1-yl)-N-[2-chloro-5-(dimethylsulfamoyl)phenyl]acetamide |
|---|---|
| PubChem CID | 16618242 |
| Molecular Formula | C22H29ClN4O3S |
| Molecular Weight | 465.02 g/mol |
| Exact Mass | 464.16 |
| IUPAC Name | 2-(4-benzyl-1,4-diazepan-1-yl)-N-[2-chloro-5-(dimethylsulfamoyl)phenyl]acetamide |
| SMILES | CN(C)S(=O)(=O)c1ccc(Cl)c(NC(=O)CN2CCCN(Cc3ccccc3)CC2)c1 |
| InChI | InChI=1S/C22H29ClN4O3S/c1-25(2)31(29,30)19-9-10-20(23)21(15-19)24-22(28)17-27-12-6-11-26(13-14-27)16-18-7-4-3-5-8-18/h3-5,7-10,15H,6,11-14,16-17H2,1-2H3,(H,24,28) |
| InChIKey | AGYLIFPHBWTQQR-UHFFFAOYSA-N |
| XLogP | 2.74 |
| TPSA | 72.96 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 465.02 |
| LogP ≤ 5 | 2.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |