C20H26N4O3S — CID 16608527
2-(4-benzyl-1,4-diazepan-1-yl)-N-(4-sulfamoylphenyl)acetamide (PubChem CID 16608527) has the molecular formula C20H26N4O3S and a molecular weight of 402.52 g/mol. Its IUPAC name is 2-(4-benzyl-1,4-diazepan-1-yl)-N-(4-sulfamoylphenyl)acetamide.
| Compound Name | 2-(4-benzyl-1,4-diazepan-1-yl)-N-(4-sulfamoylphenyl)acetamide |
|---|---|
| PubChem CID | 16608527 |
| Molecular Formula | C20H26N4O3S |
| Molecular Weight | 402.52 g/mol |
| Exact Mass | 402.17 |
| IUPAC Name | 2-(4-benzyl-1,4-diazepan-1-yl)-N-(4-sulfamoylphenyl)acetamide |
| SMILES | NS(=O)(=O)c1ccc(NC(=O)CN2CCCN(Cc3ccccc3)CC2)cc1 |
| InChI | InChI=1S/C20H26N4O3S/c21-28(26,27)19-9-7-18(8-10-19)22-20(25)16-24-12-4-11-23(13-14-24)15-17-5-2-1-3-6-17/h1-3,5-10H,4,11-16H2,(H,22,25)(H2,21,26,27) |
| InChIKey | AQECUQGWKKZPPT-UHFFFAOYSA-N |
| XLogP | 1.48 |
| TPSA | 95.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.52 |
| LogP ≤ 5 | 1.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |