C22H23F6N3O — CID 16608496
2-(4-benzyl-1,4-diazepan-1-yl)-N-[3,5-bis(trifluoromethyl)phenyl]acetamide (PubChem CID 16608496) has the molecular formula C22H23F6N3O and a molecular weight of 459.43 g/mol. Its IUPAC name is 2-(4-benzyl-1,4-diazepan-1-yl)-N-[3,5-bis(trifluoromethyl)phenyl]acetamide.
| Compound Name | 2-(4-benzyl-1,4-diazepan-1-yl)-N-[3,5-bis(trifluoromethyl)phenyl]acetamide |
|---|---|
| PubChem CID | 16608496 |
| Molecular Formula | C22H23F6N3O |
| Molecular Weight | 459.43 g/mol |
| Exact Mass | 459.17 |
| IUPAC Name | 2-(4-benzyl-1,4-diazepan-1-yl)-N-[3,5-bis(trifluoromethyl)phenyl]acetamide |
| SMILES | O=C(CN1CCCN(Cc2ccccc2)CC1)Nc1cc(C(F)(F)F)cc(C(F)(F)F)c1 |
| InChI | InChI=1S/C22H23F6N3O/c23-21(24,25)17-11-18(22(26,27)28)13-19(12-17)29-20(32)15-31-8-4-7-30(9-10-31)14-16-5-2-1-3-6-16/h1-3,5-6,11-13H,4,7-10,14-15H2,(H,29,32) |
| InChIKey | VQZFFNSPJLHNCE-UHFFFAOYSA-N |
| XLogP | 4.87 |
| TPSA | 35.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 459.43 |
| LogP ≤ 5 | 4.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |