C20H19F6N3S — CID 5260669
4-benzyl-N-[3,5-bis(trifluoromethyl)phenyl]piperazine-1-carbothioamide (PubChem CID 5260669) has the molecular formula C20H19F6N3S and a molecular weight of 447.45 g/mol. Its IUPAC name is 4-benzyl-N-[3,5-bis(trifluoromethyl)phenyl]piperazine-1-carbothioamide.
| Compound Name | 4-benzyl-N-[3,5-bis(trifluoromethyl)phenyl]piperazine-1-carbothioamide |
|---|---|
| PubChem CID | 5260669 |
| Molecular Formula | C20H19F6N3S |
| Molecular Weight | 447.45 g/mol |
| Exact Mass | 447.12 |
| IUPAC Name | 4-benzyl-N-[3,5-bis(trifluoromethyl)phenyl]piperazine-1-carbothioamide |
| SMILES | FC(F)(F)c1cc(NC(=S)N2CCN(Cc3ccccc3)CC2)cc(C(F)(F)F)c1 |
| InChI | InChI=1S/C20H19F6N3S/c21-19(22,23)15-10-16(20(24,25)26)12-17(11-15)27-18(30)29-8-6-28(7-9-29)13-14-4-2-1-3-5-14/h1-5,10-12H,6-9,13H2,(H,27,30) |
| InChIKey | UEVOGIYBBNKITJ-UHFFFAOYSA-N |
| XLogP | 5.24 |
| TPSA | 18.51 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 447.45 |
| LogP ≤ 5 | 5.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|