C19H17F6N3S — CID 4615067
N-[3,5-bis(trifluoromethyl)phenyl]-4-phenylpiperazine-1-carbothioamide (PubChem CID 4615067) has the molecular formula C19H17F6N3S and a molecular weight of 433.42 g/mol. Its IUPAC name is N-[3,5-bis(trifluoromethyl)phenyl]-4-phenylpiperazine-1-carbothioamide.
| Compound Name | N-[3,5-bis(trifluoromethyl)phenyl]-4-phenylpiperazine-1-carbothioamide |
|---|---|
| PubChem CID | 4615067 |
| Molecular Formula | C19H17F6N3S |
| Molecular Weight | 433.42 g/mol |
| Exact Mass | 433.10 |
| IUPAC Name | N-[3,5-bis(trifluoromethyl)phenyl]-4-phenylpiperazine-1-carbothioamide |
| SMILES | FC(F)(F)c1cc(NC(=S)N2CCN(c3ccccc3)CC2)cc(C(F)(F)F)c1 |
| InChI | InChI=1S/C19H17F6N3S/c20-18(21,22)13-10-14(19(23,24)25)12-15(11-13)26-17(29)28-8-6-27(7-9-28)16-4-2-1-3-5-16/h1-5,10-12H,6-9H2,(H,26,29) |
| InChIKey | BNVDCCQPVAVGQM-UHFFFAOYSA-N |
| XLogP | 5.24 |
| TPSA | 18.51 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.42 |
| LogP ≤ 5 | 5.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|