C26H23F6N3S — CID 4671158
4-benzhydryl-N-[3,5-bis(trifluoromethyl)phenyl]piperazine-1-carbothioamide (PubChem CID 4671158) has the molecular formula C26H23F6N3S and a molecular weight of 523.55 g/mol. Its IUPAC name is 4-benzhydryl-N-[3,5-bis(trifluoromethyl)phenyl]piperazine-1-carbothioamide.
| Compound Name | 4-benzhydryl-N-[3,5-bis(trifluoromethyl)phenyl]piperazine-1-carbothioamide |
|---|---|
| PubChem CID | 4671158 |
| Molecular Formula | C26H23F6N3S |
| Molecular Weight | 523.55 g/mol |
| Exact Mass | 523.15 |
| IUPAC Name | 4-benzhydryl-N-[3,5-bis(trifluoromethyl)phenyl]piperazine-1-carbothioamide |
| SMILES | FC(F)(F)c1cc(NC(=S)N2CCN(C(c3ccccc3)c3ccccc3)CC2)cc(C(F)(F)F)c1 |
| InChI | InChI=1S/C26H23F6N3S/c27-25(28,29)20-15-21(26(30,31)32)17-22(16-20)33-24(36)35-13-11-34(12-14-35)23(18-7-3-1-4-8-18)19-9-5-2-6-10-19/h1-10,15-17,23H,11-14H2,(H,33,36) |
| InChIKey | FPUWRZVXZZTLJU-UHFFFAOYSA-N |
| XLogP | 6.83 |
| TPSA | 18.51 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 523.55 |
| LogP ≤ 5 | 6.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|