C25H24F3N3OS — CID 4576253
4-benzhydryl-N-[4-(trifluoromethoxy)phenyl]piperazine-1-carbothioamide (PubChem CID 4576253) has the molecular formula C25H24F3N3OS and a molecular weight of 471.55 g/mol. Its IUPAC name is 4-benzhydryl-N-[4-(trifluoromethoxy)phenyl]piperazine-1-carbothioamide.
| Compound Name | 4-benzhydryl-N-[4-(trifluoromethoxy)phenyl]piperazine-1-carbothioamide |
|---|---|
| PubChem CID | 4576253 |
| Molecular Formula | C25H24F3N3OS |
| Molecular Weight | 471.55 g/mol |
| Exact Mass | 471.16 |
| IUPAC Name | 4-benzhydryl-N-[4-(trifluoromethoxy)phenyl]piperazine-1-carbothioamide |
| SMILES | FC(F)(F)Oc1ccc(NC(=S)N2CCN(C(c3ccccc3)c3ccccc3)CC2)cc1 |
| InChI | InChI=1S/C25H24F3N3OS/c26-25(27,28)32-22-13-11-21(12-14-22)29-24(33)31-17-15-30(16-18-31)23(19-7-3-1-4-8-19)20-9-5-2-6-10-20/h1-14,23H,15-18H2,(H,29,33) |
| InChIKey | NHUSTCBMMLGGKJ-UHFFFAOYSA-N |
| XLogP | 5.69 |
| TPSA | 27.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 471.55 |
| LogP ≤ 5 | 5.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|