C24H25N3S — CID 1109251
4-benzhydryl-N-phenylpiperazine-1-carbothioamide (PubChem CID 1109251) has the molecular formula C24H25N3S and a molecular weight of 387.55 g/mol. Its IUPAC name is 4-benzhydryl-N-phenylpiperazine-1-carbothioamide.
| Compound Name | 4-benzhydryl-N-phenylpiperazine-1-carbothioamide |
|---|---|
| PubChem CID | 1109251 |
| Molecular Formula | C24H25N3S |
| Molecular Weight | 387.55 g/mol |
| Exact Mass | 387.18 |
| IUPAC Name | 4-benzhydryl-N-phenylpiperazine-1-carbothioamide |
| SMILES | S=C(Nc1ccccc1)N1CCN(C(c2ccccc2)c2ccccc2)CC1 |
| InChI | InChI=1S/C24H25N3S/c28-24(25-22-14-8-3-9-15-22)27-18-16-26(17-19-27)23(20-10-4-1-5-11-20)21-12-6-2-7-13-21/h1-15,23H,16-19H2,(H,25,28) |
| InChIKey | IKCLESDMCSMYBE-UHFFFAOYSA-N |
| XLogP | 4.79 |
| TPSA | 18.51 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.55 |
| LogP ≤ 5 | 4.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|