C26H29N3S — CID 1076538
4-benzhydryl-N-(3,5-dimethylphenyl)piperazine-1-carbothioamide (PubChem CID 1076538) has the molecular formula C26H29N3S and a molecular weight of 415.61 g/mol. Its IUPAC name is 4-benzhydryl-N-(3,5-dimethylphenyl)piperazine-1-carbothioamide.
| Compound Name | 4-benzhydryl-N-(3,5-dimethylphenyl)piperazine-1-carbothioamide |
|---|---|
| PubChem CID | 1076538 |
| Molecular Formula | C26H29N3S |
| Molecular Weight | 415.61 g/mol |
| Exact Mass | 415.21 |
| IUPAC Name | 4-benzhydryl-N-(3,5-dimethylphenyl)piperazine-1-carbothioamide |
| SMILES | Cc1cc(C)cc(NC(=S)N2CCN(C(c3ccccc3)c3ccccc3)CC2)c1 |
| InChI | InChI=1S/C26H29N3S/c1-20-17-21(2)19-24(18-20)27-26(30)29-15-13-28(14-16-29)25(22-9-5-3-6-10-22)23-11-7-4-8-12-23/h3-12,17-19,25H,13-16H2,1-2H3,(H,27,30) |
| InChIKey | RROPWBCZFYGVIE-UHFFFAOYSA-N |
| XLogP | 5.41 |
| TPSA | 18.51 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.61 |
| LogP ≤ 5 | 5.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|