C22H27N3S — CID 100567403
4-(2,3-dihydro-1H-inden-2-yl)-N-(3,5-dimethylphenyl)piperazine-1-carbothioamide (PubChem CID 100567403) has the molecular formula C22H27N3S and a molecular weight of 365.55 g/mol. Its IUPAC name is 4-(2,3-dihydro-1H-inden-2-yl)-N-(3,5-dimethylphenyl)piperazine-1-carbothioamide.
| Compound Name | 4-(2,3-dihydro-1H-inden-2-yl)-N-(3,5-dimethylphenyl)piperazine-1-carbothioamide |
|---|---|
| PubChem CID | 100567403 |
| Molecular Formula | C22H27N3S |
| Molecular Weight | 365.55 g/mol |
| Exact Mass | 365.19 |
| IUPAC Name | 4-(2,3-dihydro-1H-inden-2-yl)-N-(3,5-dimethylphenyl)piperazine-1-carbothioamide |
| SMILES | Cc1cc(C)cc(NC(=S)N2CCN(C3Cc4ccccc4C3)CC2)c1 |
| InChI | InChI=1S/C22H27N3S/c1-16-11-17(2)13-20(12-16)23-22(26)25-9-7-24(8-10-25)21-14-18-5-3-4-6-19(18)15-21/h3-6,11-13,21H,7-10,14-15H2,1-2H3,(H,23,26) |
| InChIKey | XUBZPHPLKSTRPL-UHFFFAOYSA-N |
| XLogP | 3.79 |
| TPSA | 18.51 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.55 |
| LogP ≤ 5 | 3.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|