C23H28N6O2S — CID 17322227
4-[5-(3,4-dimethoxyphenyl)tetrazol-2-yl]-N-(3,5-dimethylphenyl)piperidine-1-carbothioamide (PubChem CID 17322227) has the molecular formula C23H28N6O2S and a molecular weight of 452.58 g/mol. Its IUPAC name is 4-[5-(3,4-dimethoxyphenyl)tetrazol-2-yl]-N-(3,5-dimethylphenyl)piperidine-1-carbothioamide.
| Compound Name | 4-[5-(3,4-dimethoxyphenyl)tetrazol-2-yl]-N-(3,5-dimethylphenyl)piperidine-1-carbothioamide |
|---|---|
| PubChem CID | 17322227 |
| Molecular Formula | C23H28N6O2S |
| Molecular Weight | 452.58 g/mol |
| Exact Mass | 452.20 |
| IUPAC Name | 4-[5-(3,4-dimethoxyphenyl)tetrazol-2-yl]-N-(3,5-dimethylphenyl)piperidine-1-carbothioamide |
| SMILES | COc1ccc(-c2nnn(C3CCN(C(=S)Nc4cc(C)cc(C)c4)CC3)n2)cc1OC |
| InChI | InChI=1S/C23H28N6O2S/c1-15-11-16(2)13-18(12-15)24-23(32)28-9-7-19(8-10-28)29-26-22(25-27-29)17-5-6-20(30-3)21(14-17)31-4/h5-6,11-14,19H,7-10H2,1-4H3,(H,24,32) |
| InChIKey | IHOQMTBHYCHCMN-UHFFFAOYSA-N |
| XLogP | 4.01 |
| TPSA | 77.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.58 |
| LogP ≤ 5 | 4.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|