C19H22N6S2 — CID 17322208
N-(3,4-dimethylphenyl)-4-(5-thiophen-2-yltetrazol-2-yl)piperidine-1-carbothioamide (PubChem CID 17322208) has the molecular formula C19H22N6S2 and a molecular weight of 398.56 g/mol. Its IUPAC name is N-(3,4-dimethylphenyl)-4-(5-thiophen-2-yltetrazol-2-yl)piperidine-1-carbothioamide.
| Compound Name | N-(3,4-dimethylphenyl)-4-(5-thiophen-2-yltetrazol-2-yl)piperidine-1-carbothioamide |
|---|---|
| PubChem CID | 17322208 |
| Molecular Formula | C19H22N6S2 |
| Molecular Weight | 398.56 g/mol |
| Exact Mass | 398.13 |
| IUPAC Name | N-(3,4-dimethylphenyl)-4-(5-thiophen-2-yltetrazol-2-yl)piperidine-1-carbothioamide |
| SMILES | Cc1ccc(NC(=S)N2CCC(n3nnc(-c4cccs4)n3)CC2)cc1C |
| InChI | InChI=1S/C19H22N6S2/c1-13-5-6-15(12-14(13)2)20-19(26)24-9-7-16(8-10-24)25-22-18(21-23-25)17-4-3-11-27-17/h3-6,11-12,16H,7-10H2,1-2H3,(H,20,26) |
| InChIKey | UTTNAVLJTOCCGY-UHFFFAOYSA-N |
| XLogP | 4.05 |
| TPSA | 58.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.56 |
| LogP ≤ 5 | 4.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|