C12H13N5O3S — CID 11324251
methyl 6-oxo-5-(5-thiophen-2-yltetrazol-2-yl)piperidine-2-carboxylate (PubChem CID 11324251) has the molecular formula C12H13N5O3S and a molecular weight of 307.33 g/mol. Its IUPAC name is methyl 6-oxo-5-(5-thiophen-2-yltetrazol-2-yl)piperidine-2-carboxylate.
| Compound Name | methyl 6-oxo-5-(5-thiophen-2-yltetrazol-2-yl)piperidine-2-carboxylate |
|---|---|
| PubChem CID | 11324251 |
| Molecular Formula | C12H13N5O3S |
| Molecular Weight | 307.33 g/mol |
| Exact Mass | 307.07 |
| IUPAC Name | methyl 6-oxo-5-(5-thiophen-2-yltetrazol-2-yl)piperidine-2-carboxylate |
| SMILES | COC(=O)C1CCC(n2nnc(-c3cccs3)n2)C(=O)N1 |
| InChI | InChI=1S/C12H13N5O3S/c1-20-12(19)7-4-5-8(11(18)13-7)17-15-10(14-16-17)9-3-2-6-21-9/h2-3,6-8H,4-5H2,1H3,(H,13,18) |
| InChIKey | WLMARFYLCONPIY-UHFFFAOYSA-N |
| XLogP | 0.39 |
| TPSA | 99.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.33 |
| LogP ≤ 5 | 0.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |