C21H22N6O4S2 — CID 17322220
dimethyl 5-[[4-(5-thiophen-2-yltetrazol-2-yl)piperidine-1-carbothioyl]amino]benzene-1,3-dicarboxylate (PubChem CID 17322220) has the molecular formula C21H22N6O4S2 and a molecular weight of 486.58 g/mol. Its IUPAC name is dimethyl 5-[[4-(5-thiophen-2-yltetrazol-2-yl)piperidine-1-carbothioyl]amino]benzene-1,3-dicarboxylate.
| Compound Name | dimethyl 5-[[4-(5-thiophen-2-yltetrazol-2-yl)piperidine-1-carbothioyl]amino]benzene-1,3-dicarboxylate |
|---|---|
| PubChem CID | 17322220 |
| Molecular Formula | C21H22N6O4S2 |
| Molecular Weight | 486.58 g/mol |
| Exact Mass | 486.11 |
| IUPAC Name | dimethyl 5-[[4-(5-thiophen-2-yltetrazol-2-yl)piperidine-1-carbothioyl]amino]benzene-1,3-dicarboxylate |
| SMILES | COC(=O)c1cc(NC(=S)N2CCC(n3nnc(-c4cccs4)n3)CC2)cc(C(=O)OC)c1 |
| InChI | InChI=1S/C21H22N6O4S2/c1-30-19(28)13-10-14(20(29)31-2)12-15(11-13)22-21(32)26-7-5-16(6-8-26)27-24-18(23-25-27)17-4-3-9-33-17/h3-4,9-12,16H,5-8H2,1-2H3,(H,22,32) |
| InChIKey | HQTCMVVZNZUNGW-UHFFFAOYSA-N |
| XLogP | 3.01 |
| TPSA | 111.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 486.58 |
| LogP ≤ 5 | 3.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|