C13H17N3O3S2 — CID 4610946
methyl 3-[(4-carbamoylpiperidine-1-carbothioyl)amino]thiophene-2-carboxylate (PubChem CID 4610946) has the molecular formula C13H17N3O3S2 and a molecular weight of 327.43 g/mol. Its IUPAC name is methyl 3-[(4-carbamoylpiperidine-1-carbothioyl)amino]thiophene-2-carboxylate.
| Compound Name | methyl 3-[(4-carbamoylpiperidine-1-carbothioyl)amino]thiophene-2-carboxylate |
|---|---|
| PubChem CID | 4610946 |
| Molecular Formula | C13H17N3O3S2 |
| Molecular Weight | 327.43 g/mol |
| Exact Mass | 327.07 |
| IUPAC Name | methyl 3-[(4-carbamoylpiperidine-1-carbothioyl)amino]thiophene-2-carboxylate |
| SMILES | COC(=O)c1sccc1NC(=S)N1CCC(C(N)=O)CC1 |
| InChI | InChI=1S/C13H17N3O3S2/c1-19-12(18)10-9(4-7-21-10)15-13(20)16-5-2-8(3-6-16)11(14)17/h4,7-8H,2-3,5-6H2,1H3,(H2,14,17)(H,15,20) |
| InChIKey | HHDDJVVDNMHSGL-UHFFFAOYSA-N |
| XLogP | 1.43 |
| TPSA | 84.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.43 |
| LogP ≤ 5 | 1.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|