C12H16N2O3S2 — CID 114291899
methyl 3-[(2-carbamothioyl-2-methylbutanoyl)amino]thiophene-2-carboxylate (PubChem CID 114291899) has the molecular formula C12H16N2O3S2 and a molecular weight of 300.40 g/mol. Its IUPAC name is methyl 3-[(2-carbamothioyl-2-methylbutanoyl)amino]thiophene-2-carboxylate.
| Compound Name | methyl 3-[(2-carbamothioyl-2-methylbutanoyl)amino]thiophene-2-carboxylate |
|---|---|
| PubChem CID | 114291899 |
| Molecular Formula | C12H16N2O3S2 |
| Molecular Weight | 300.40 g/mol |
| Exact Mass | 300.06 |
| IUPAC Name | methyl 3-[(2-carbamothioyl-2-methylbutanoyl)amino]thiophene-2-carboxylate |
| SMILES | CCC(C)(C(=O)Nc1ccsc1C(=O)OC)C(N)=S |
| InChI | InChI=1S/C12H16N2O3S2/c1-4-12(2,10(13)18)11(16)14-7-5-6-19-8(7)9(15)17-3/h5-6H,4H2,1-3H3,(H2,13,18)(H,14,16) |
| InChIKey | GCELKAHJYYUSNQ-UHFFFAOYSA-N |
| XLogP | 2.18 |
| TPSA | 81.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.40 |
| LogP ≤ 5 | 2.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|