C10H14N2O2S2 — CID 19655448
methyl 3-(propylcarbamothioylamino)thiophene-2-carboxylate (PubChem CID 19655448) has the molecular formula C10H14N2O2S2 and a molecular weight of 258.37 g/mol. Its IUPAC name is methyl 3-(propylcarbamothioylamino)thiophene-2-carboxylate.
| Compound Name | methyl 3-(propylcarbamothioylamino)thiophene-2-carboxylate |
|---|---|
| PubChem CID | 19655448 |
| Molecular Formula | C10H14N2O2S2 |
| Molecular Weight | 258.37 g/mol |
| Exact Mass | 258.05 |
| IUPAC Name | methyl 3-(propylcarbamothioylamino)thiophene-2-carboxylate |
| SMILES | CCCNC(=S)Nc1ccsc1C(=O)OC |
| InChI | InChI=1S/C10H14N2O2S2/c1-3-5-11-10(15)12-7-4-6-16-8(7)9(13)14-2/h4,6H,3,5H2,1-2H3,(H2,11,12,15) |
| InChIKey | KVIJYHFMDZPWLO-UHFFFAOYSA-N |
| XLogP | 2.23 |
| TPSA | 50.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 258.37 |
| LogP ≤ 5 | 2.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|