C10H14N2O3S — CID 172785688
methyl 3-(propylcarbamothioylamino)furan-2-carboxylate (PubChem CID 172785688) has the molecular formula C10H14N2O3S and a molecular weight of 242.30 g/mol. Its IUPAC name is methyl 3-(propylcarbamothioylamino)furan-2-carboxylate.
| Compound Name | methyl 3-(propylcarbamothioylamino)furan-2-carboxylate |
|---|---|
| PubChem CID | 172785688 |
| Molecular Formula | C10H14N2O3S |
| Molecular Weight | 242.30 g/mol |
| Exact Mass | 242.07 |
| IUPAC Name | methyl 3-(propylcarbamothioylamino)furan-2-carboxylate |
| SMILES | CCCNC(=S)Nc1ccoc1C(=O)OC |
| InChI | InChI=1S/C10H14N2O3S/c1-3-5-11-10(16)12-7-4-6-15-8(7)9(13)14-2/h4,6H,3,5H2,1-2H3,(H2,11,12,16) |
| InChIKey | OVZPBXOADGZZEA-UHFFFAOYSA-N |
| XLogP | 1.76 |
| TPSA | 63.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 242.30 |
| LogP ≤ 5 | 1.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|