C11H17NO5S — CID 103921879
methyl 3-[(2-ethylsulfonylethylamino)methyl]furan-2-carboxylate (PubChem CID 103921879) has the molecular formula C11H17NO5S and a molecular weight of 275.33 g/mol. Its IUPAC name is methyl 3-[(2-ethylsulfonylethylamino)methyl]furan-2-carboxylate.
| Compound Name | methyl 3-[(2-ethylsulfonylethylamino)methyl]furan-2-carboxylate |
|---|---|
| PubChem CID | 103921879 |
| Molecular Formula | C11H17NO5S |
| Molecular Weight | 275.33 g/mol |
| Exact Mass | 275.08 |
| IUPAC Name | methyl 3-[(2-ethylsulfonylethylamino)methyl]furan-2-carboxylate |
| SMILES | CCS(=O)(=O)CCNCc1ccoc1C(=O)OC |
| InChI | InChI=1S/C11H17NO5S/c1-3-18(14,15)7-5-12-8-9-4-6-17-10(9)11(13)16-2/h4,6,12H,3,5,7-8H2,1-2H3 |
| InChIKey | TXNISJAIPPZMHJ-UHFFFAOYSA-N |
| XLogP | 0.59 |
| TPSA | 85.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.33 |
| LogP ≤ 5 | 0.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|