C11H18N2O3 — CID 43424817
methyl 3-[[2-(dimethylamino)ethylamino]methyl]furan-2-carboxylate (PubChem CID 43424817) has the molecular formula C11H18N2O3 and a molecular weight of 226.28 g/mol. Its IUPAC name is methyl 3-[[2-(dimethylamino)ethylamino]methyl]furan-2-carboxylate.
| Compound Name | methyl 3-[[2-(dimethylamino)ethylamino]methyl]furan-2-carboxylate |
|---|---|
| PubChem CID | 43424817 |
| Molecular Formula | C11H18N2O3 |
| Molecular Weight | 226.28 g/mol |
| Exact Mass | 226.13 |
| IUPAC Name | methyl 3-[[2-(dimethylamino)ethylamino]methyl]furan-2-carboxylate |
| SMILES | COC(=O)c1occc1CNCCN(C)C |
| InChI | InChI=1S/C11H18N2O3/c1-13(2)6-5-12-8-9-4-7-16-10(9)11(14)15-3/h4,7,12H,5-6,8H2,1-3H3 |
| InChIKey | GUUVULHNSZTDSF-UHFFFAOYSA-N |
| XLogP | 0.72 |
| TPSA | 54.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 226.28 |
| LogP ≤ 5 | 0.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|