C11H15NO5 — CID 60782689
4-[(2-methoxycarbonylfuran-3-yl)methylamino]butanoic acid (PubChem CID 60782689) has the molecular formula C11H15NO5 and a molecular weight of 241.24 g/mol. Its IUPAC name is 4-[(2-methoxycarbonylfuran-3-yl)methylamino]butanoic acid.
| Compound Name | 4-[(2-methoxycarbonylfuran-3-yl)methylamino]butanoic acid |
|---|---|
| PubChem CID | 60782689 |
| Molecular Formula | C11H15NO5 |
| Molecular Weight | 241.24 g/mol |
| Exact Mass | 241.10 |
| IUPAC Name | 4-[(2-methoxycarbonylfuran-3-yl)methylamino]butanoic acid |
| SMILES | COC(=O)c1occc1CNCCCC(=O)O |
| InChI | InChI=1S/C11H15NO5/c1-16-11(15)10-8(4-6-17-10)7-12-5-2-3-9(13)14/h4,6,12H,2-3,5,7H2,1H3,(H,13,14) |
| InChIKey | CSKLMDYNBCBZAJ-UHFFFAOYSA-N |
| XLogP | 1.02 |
| TPSA | 88.77 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 241.24 |
| LogP ≤ 5 | 1.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|