C13H17N3O3 — CID 43425142
methyl 3-[(3-imidazol-1-ylpropylamino)methyl]furan-2-carboxylate (PubChem CID 43425142) has the molecular formula C13H17N3O3 and a molecular weight of 263.30 g/mol. Its IUPAC name is methyl 3-[(3-imidazol-1-ylpropylamino)methyl]furan-2-carboxylate.
| Compound Name | methyl 3-[(3-imidazol-1-ylpropylamino)methyl]furan-2-carboxylate |
|---|---|
| PubChem CID | 43425142 |
| Molecular Formula | C13H17N3O3 |
| Molecular Weight | 263.30 g/mol |
| Exact Mass | 263.13 |
| IUPAC Name | methyl 3-[(3-imidazol-1-ylpropylamino)methyl]furan-2-carboxylate |
| SMILES | COC(=O)c1occc1CNCCCn1ccnc1 |
| InChI | InChI=1S/C13H17N3O3/c1-18-13(17)12-11(3-8-19-12)9-14-4-2-6-16-7-5-15-10-16/h3,5,7-8,10,14H,2,4,6,9H2,1H3 |
| InChIKey | QICIBCXSDHUZOC-UHFFFAOYSA-N |
| XLogP | 1.44 |
| TPSA | 69.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 263.30 |
| LogP ≤ 5 | 1.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|