C10H14N4O — CID 81176934
3-imidazol-1-yl-N-(1,2-oxazol-3-ylmethyl)propan-1-amine (PubChem CID 81176934) has the molecular formula C10H14N4O and a molecular weight of 206.25 g/mol. Its IUPAC name is 3-imidazol-1-yl-N-(1,2-oxazol-3-ylmethyl)propan-1-amine.
| Compound Name | 3-imidazol-1-yl-N-(1,2-oxazol-3-ylmethyl)propan-1-amine |
|---|---|
| PubChem CID | 81176934 |
| Molecular Formula | C10H14N4O |
| Molecular Weight | 206.25 g/mol |
| Exact Mass | 206.12 |
| IUPAC Name | 3-imidazol-1-yl-N-(1,2-oxazol-3-ylmethyl)propan-1-amine |
| SMILES | c1cn(CCCNCc2ccon2)cn1 |
| InChI | InChI=1S/C10H14N4O/c1(5-14-6-4-12-9-14)3-11-8-10-2-7-15-13-10/h2,4,6-7,9,11H,1,3,5,8H2 |
| InChIKey | IJOFQLCARPHORD-UHFFFAOYSA-N |
| XLogP | 1.05 |
| TPSA | 55.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 206.25 |
| LogP ≤ 5 | 1.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|