C10H16N6 — CID 62756118
3-imidazol-1-yl-N-[(1-methyltriazol-4-yl)methyl]propan-1-amine (PubChem CID 62756118) has the molecular formula C10H16N6 and a molecular weight of 220.28 g/mol. Its IUPAC name is 3-imidazol-1-yl-N-[(1-methyltriazol-4-yl)methyl]propan-1-amine.
| Compound Name | 3-imidazol-1-yl-N-[(1-methyltriazol-4-yl)methyl]propan-1-amine |
|---|---|
| PubChem CID | 62756118 |
| Molecular Formula | C10H16N6 |
| Molecular Weight | 220.28 g/mol |
| Exact Mass | 220.14 |
| IUPAC Name | 3-imidazol-1-yl-N-[(1-methyltriazol-4-yl)methyl]propan-1-amine |
| SMILES | Cn1cc(CNCCCn2ccnc2)nn1 |
| InChI | InChI=1S/C10H16N6/c1-15-8-10(13-14-15)7-11-3-2-5-16-6-4-12-9-16/h4,6,8-9,11H,2-3,5,7H2,1H3 |
| InChIKey | LBCNHGAVLDPSOH-UHFFFAOYSA-N |
| XLogP | 0.19 |
| TPSA | 60.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 220.28 |
| LogP ≤ 5 | 0.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|