C7H13N5O — CID 62755404
3-[(1-methyltriazol-4-yl)methylamino]propanamide (PubChem CID 62755404) has the molecular formula C7H13N5O and a molecular weight of 183.22 g/mol. Its IUPAC name is 3-[(1-methyltriazol-4-yl)methylamino]propanamide.
| Compound Name | 3-[(1-methyltriazol-4-yl)methylamino]propanamide |
|---|---|
| PubChem CID | 62755404 |
| Molecular Formula | C7H13N5O |
| Molecular Weight | 183.22 g/mol |
| Exact Mass | 183.11 |
| IUPAC Name | 3-[(1-methyltriazol-4-yl)methylamino]propanamide |
| SMILES | Cn1cc(CNCCC(N)=O)nn1 |
| InChI | InChI=1S/C7H13N5O/c1-12-5-6(10-11-12)4-9-3-2-7(8)13/h5,9H,2-4H2,1H3,(H2,8,13) |
| InChIKey | IRRWCHHJEWDEDC-UHFFFAOYSA-N |
| XLogP | -1.22 |
| TPSA | 85.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 183.22 |
| LogP ≤ 5 | -1.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|