C7H14N4O2 — CID 66176969
3-[(1-methyltriazol-4-yl)methylamino]propane-1,2-diol (PubChem CID 66176969) has the molecular formula C7H14N4O2 and a molecular weight of 186.21 g/mol. Its IUPAC name is 3-[(1-methyltriazol-4-yl)methylamino]propane-1,2-diol.
| Compound Name | 3-[(1-methyltriazol-4-yl)methylamino]propane-1,2-diol |
|---|---|
| PubChem CID | 66176969 |
| Molecular Formula | C7H14N4O2 |
| Molecular Weight | 186.21 g/mol |
| Exact Mass | 186.11 |
| IUPAC Name | 3-[(1-methyltriazol-4-yl)methylamino]propane-1,2-diol |
| SMILES | Cn1cc(CNCC(O)CO)nn1 |
| InChI | InChI=1S/C7H14N4O2/c1-11-4-6(9-10-11)2-8-3-7(13)5-12/h4,7-8,12-13H,2-3,5H2,1H3 |
| InChIKey | AHGDMFBWWGGYIF-UHFFFAOYSA-N |
| XLogP | -1.74 |
| TPSA | 83.20 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 186.21 |
| LogP ≤ 5 | -1.74 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |