C10H20N4O2 — CID 103399191
3-[(1-tert-butyltriazol-4-yl)methylamino]propane-1,2-diol (PubChem CID 103399191) has the molecular formula C10H20N4O2 and a molecular weight of 228.30 g/mol. Its IUPAC name is 3-[(1-tert-butyltriazol-4-yl)methylamino]propane-1,2-diol.
| Compound Name | 3-[(1-tert-butyltriazol-4-yl)methylamino]propane-1,2-diol |
|---|---|
| PubChem CID | 103399191 |
| Molecular Formula | C10H20N4O2 |
| Molecular Weight | 228.30 g/mol |
| Exact Mass | 228.16 |
| IUPAC Name | 3-[(1-tert-butyltriazol-4-yl)methylamino]propane-1,2-diol |
| SMILES | CC(C)(C)n1cc(CNCC(O)CO)nn1 |
| InChI | InChI=1S/C10H20N4O2/c1-10(2,3)14-6-8(12-13-14)4-11-5-9(16)7-15/h6,9,11,15-16H,4-5,7H2,1-3H3 |
| InChIKey | VJXLJEIASVPTNH-UHFFFAOYSA-N |
| XLogP | -0.52 |
| TPSA | 83.20 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 228.30 |
| LogP ≤ 5 | -0.52 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |