C10H17F3N4 — CID 103399091
N-[(1-tert-butyltriazol-4-yl)methyl]-3,3,3-trifluoropropan-1-amine (PubChem CID 103399091) has the molecular formula C10H17F3N4 and a molecular weight of 250.27 g/mol. Its IUPAC name is N-[(1-tert-butyltriazol-4-yl)methyl]-3,3,3-trifluoropropan-1-amine.
| Compound Name | N-[(1-tert-butyltriazol-4-yl)methyl]-3,3,3-trifluoropropan-1-amine |
|---|---|
| PubChem CID | 103399091 |
| Molecular Formula | C10H17F3N4 |
| Molecular Weight | 250.27 g/mol |
| Exact Mass | 250.14 |
| IUPAC Name | N-[(1-tert-butyltriazol-4-yl)methyl]-3,3,3-trifluoropropan-1-amine |
| SMILES | CC(C)(C)n1cc(CNCCC(F)(F)F)nn1 |
| InChI | InChI=1S/C10H17F3N4/c1-9(2,3)17-7-8(15-16-17)6-14-5-4-10(11,12)13/h7,14H,4-6H2,1-3H3 |
| InChIKey | CPPPDATVYMPTKX-UHFFFAOYSA-N |
| XLogP | 2.08 |
| TPSA | 42.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 250.27 |
| LogP ≤ 5 | 2.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|