C13H25N5O — CID 103399299
N-tert-butyl-2-[(1-tert-butyltriazol-4-yl)methylamino]acetamide (PubChem CID 103399299) has the molecular formula C13H25N5O and a molecular weight of 267.38 g/mol. Its IUPAC name is N-tert-butyl-2-[(1-tert-butyltriazol-4-yl)methylamino]acetamide.
| Compound Name | N-tert-butyl-2-[(1-tert-butyltriazol-4-yl)methylamino]acetamide |
|---|---|
| PubChem CID | 103399299 |
| Molecular Formula | C13H25N5O |
| Molecular Weight | 267.38 g/mol |
| Exact Mass | 267.21 |
| IUPAC Name | N-tert-butyl-2-[(1-tert-butyltriazol-4-yl)methylamino]acetamide |
| SMILES | CC(C)(C)NC(=O)CNCc1cn(C(C)(C)C)nn1 |
| InChI | InChI=1S/C13H25N5O/c1-12(2,3)15-11(19)8-14-7-10-9-18(17-16-10)13(4,5)6/h9,14H,7-8H2,1-6H3,(H,15,19) |
| InChIKey | CESMSOLQFVRLRF-UHFFFAOYSA-N |
| XLogP | 1.04 |
| TPSA | 71.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 267.38 |
| LogP ≤ 5 | 1.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |