C9H15ClN4O — CID 166418934
N-[(1-tert-butyltriazol-4-yl)methyl]-2-chloroacetamide (PubChem CID 166418934) has the molecular formula C9H15ClN4O and a molecular weight of 230.70 g/mol. Its IUPAC name is N-[(1-tert-butyltriazol-4-yl)methyl]-2-chloroacetamide.
| Compound Name | N-[(1-tert-butyltriazol-4-yl)methyl]-2-chloroacetamide |
|---|---|
| PubChem CID | 166418934 |
| Molecular Formula | C9H15ClN4O |
| Molecular Weight | 230.70 g/mol |
| Exact Mass | 230.09 |
| IUPAC Name | N-[(1-tert-butyltriazol-4-yl)methyl]-2-chloroacetamide |
| SMILES | CC(C)(C)n1cc(CNC(=O)CCl)nn1 |
| InChI | InChI=1S/C9H15ClN4O/c1-9(2,3)14-6-7(12-13-14)5-11-8(15)4-10/h6H,4-5H2,1-3H3,(H,11,15) |
| InChIKey | BTPABEMEOBYUHU-UHFFFAOYSA-N |
| XLogP | 0.89 |
| TPSA | 59.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 230.70 |
| LogP ≤ 5 | 0.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|