C16H31N5O2 — CID 103527141
tert-butyl N-[2-[(1-tert-butyltriazol-4-yl)methylamino]-2-methylpropyl]carbamate (PubChem CID 103527141) has the molecular formula C16H31N5O2 and a molecular weight of 325.46 g/mol. Its IUPAC name is tert-butyl N-[2-[(1-tert-butyltriazol-4-yl)methylamino]-2-methylpropyl]carbamate.
| Compound Name | tert-butyl N-[2-[(1-tert-butyltriazol-4-yl)methylamino]-2-methylpropyl]carbamate |
|---|---|
| PubChem CID | 103527141 |
| Molecular Formula | C16H31N5O2 |
| Molecular Weight | 325.46 g/mol |
| Exact Mass | 325.25 |
| IUPAC Name | tert-butyl N-[2-[(1-tert-butyltriazol-4-yl)methylamino]-2-methylpropyl]carbamate |
| SMILES | CC(C)(CNC(=O)OC(C)(C)C)NCc1cn(C(C)(C)C)nn1 |
| InChI | InChI=1S/C16H31N5O2/c1-14(2,3)21-10-12(19-20-21)9-18-16(7,8)11-17-13(22)23-15(4,5)6/h10,18H,9,11H2,1-8H3,(H,17,22) |
| InChIKey | HSSAVNFRUSPWNR-UHFFFAOYSA-N |
| XLogP | 2.43 |
| TPSA | 81.07 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.46 |
| LogP ≤ 5 | 2.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |