C16H31N5O2 — CID 107250505
tert-butyl N-[1-[(1-tert-butyltriazol-4-yl)methylamino]butan-2-yl]carbamate (PubChem CID 107250505) has the molecular formula C16H31N5O2 and a molecular weight of 325.46 g/mol. Its IUPAC name is tert-butyl N-[1-[(1-tert-butyltriazol-4-yl)methylamino]butan-2-yl]carbamate.
| Compound Name | tert-butyl N-[1-[(1-tert-butyltriazol-4-yl)methylamino]butan-2-yl]carbamate |
|---|---|
| PubChem CID | 107250505 |
| Molecular Formula | C16H31N5O2 |
| Molecular Weight | 325.46 g/mol |
| Exact Mass | 325.25 |
| IUPAC Name | tert-butyl N-[1-[(1-tert-butyltriazol-4-yl)methylamino]butan-2-yl]carbamate |
| SMILES | CCC(CNCc1cn(C(C)(C)C)nn1)NC(=O)OC(C)(C)C |
| InChI | InChI=1S/C16H31N5O2/c1-8-12(18-14(22)23-16(5,6)7)9-17-10-13-11-21(20-19-13)15(2,3)4/h11-12,17H,8-10H2,1-7H3,(H,18,22) |
| InChIKey | QXPFVGWHKXYUSF-UHFFFAOYSA-N |
| XLogP | 2.43 |
| TPSA | 81.07 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.46 |
| LogP ≤ 5 | 2.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |