C15H25N3O2 — CID 107250270
tert-butyl N-[1-(pyridin-4-ylmethylamino)butan-2-yl]carbamate (PubChem CID 107250270) has the molecular formula C15H25N3O2 and a molecular weight of 279.38 g/mol. Its IUPAC name is tert-butyl N-[1-(pyridin-4-ylmethylamino)butan-2-yl]carbamate.
| Compound Name | tert-butyl N-[1-(pyridin-4-ylmethylamino)butan-2-yl]carbamate |
|---|---|
| PubChem CID | 107250270 |
| Molecular Formula | C15H25N3O2 |
| Molecular Weight | 279.38 g/mol |
| Exact Mass | 279.19 |
| IUPAC Name | tert-butyl N-[1-(pyridin-4-ylmethylamino)butan-2-yl]carbamate |
| SMILES | CCC(CNCc1ccncc1)NC(=O)OC(C)(C)C |
| InChI | InChI=1S/C15H25N3O2/c1-5-13(18-14(19)20-15(2,3)4)11-17-10-12-6-8-16-9-7-12/h6-9,13,17H,5,10-11H2,1-4H3,(H,18,19) |
| InChIKey | LKVDDOPBTFYKGJ-UHFFFAOYSA-N |
| XLogP | 2.47 |
| TPSA | 63.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 279.38 |
| LogP ≤ 5 | 2.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |