C16H24BrClN2O2 — CID 107250724
tert-butyl N-[1-[(3-bromo-4-chlorophenyl)methylamino]butan-2-yl]carbamate (PubChem CID 107250724) has the molecular formula C16H24BrClN2O2 and a molecular weight of 391.74 g/mol. Its IUPAC name is tert-butyl N-[1-[(3-bromo-4-chlorophenyl)methylamino]butan-2-yl]carbamate.
| Compound Name | tert-butyl N-[1-[(3-bromo-4-chlorophenyl)methylamino]butan-2-yl]carbamate |
|---|---|
| PubChem CID | 107250724 |
| Molecular Formula | C16H24BrClN2O2 |
| Molecular Weight | 391.74 g/mol |
| Exact Mass | 390.07 |
| IUPAC Name | tert-butyl N-[1-[(3-bromo-4-chlorophenyl)methylamino]butan-2-yl]carbamate |
| SMILES | CCC(CNCc1ccc(Cl)c(Br)c1)NC(=O)OC(C)(C)C |
| InChI | InChI=1S/C16H24BrClN2O2/c1-5-12(20-15(21)22-16(2,3)4)10-19-9-11-6-7-14(18)13(17)8-11/h6-8,12,19H,5,9-10H2,1-4H3,(H,20,21) |
| InChIKey | DGQFVOVKCPNYCD-UHFFFAOYSA-N |
| XLogP | 4.50 |
| TPSA | 50.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.74 |
| LogP ≤ 5 | 4.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |