C15H20BrClN2O2 — CID 107238328
tert-butyl N-[2-[(3-bromo-4-chlorophenyl)methylamino]cyclopropyl]carbamate (PubChem CID 107238328) has the molecular formula C15H20BrClN2O2 and a molecular weight of 375.69 g/mol. Its IUPAC name is tert-butyl N-[2-[(3-bromo-4-chlorophenyl)methylamino]cyclopropyl]carbamate.
| Compound Name | tert-butyl N-[2-[(3-bromo-4-chlorophenyl)methylamino]cyclopropyl]carbamate |
|---|---|
| PubChem CID | 107238328 |
| Molecular Formula | C15H20BrClN2O2 |
| Molecular Weight | 375.69 g/mol |
| Exact Mass | 374.04 |
| IUPAC Name | tert-butyl N-[2-[(3-bromo-4-chlorophenyl)methylamino]cyclopropyl]carbamate |
| SMILES | CC(C)(C)OC(=O)NC1CC1NCc1ccc(Cl)c(Br)c1 |
| InChI | InChI=1S/C15H20BrClN2O2/c1-15(2,3)21-14(20)19-13-7-12(13)18-8-9-4-5-11(17)10(16)6-9/h4-6,12-13,18H,7-8H2,1-3H3,(H,19,20) |
| InChIKey | POAWTDCTLFPJPS-UHFFFAOYSA-N |
| XLogP | 3.86 |
| TPSA | 50.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.69 |
| LogP ≤ 5 | 3.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |