C15H20BrClN2O2 — CID 107241982
tert-butyl 3-[(3-bromo-4-chlorophenyl)methylamino]azetidine-1-carboxylate (PubChem CID 107241982) has the molecular formula C15H20BrClN2O2 and a molecular weight of 375.69 g/mol. Its IUPAC name is tert-butyl 3-[(3-bromo-4-chlorophenyl)methylamino]azetidine-1-carboxylate.
| Compound Name | tert-butyl 3-[(3-bromo-4-chlorophenyl)methylamino]azetidine-1-carboxylate |
|---|---|
| PubChem CID | 107241982 |
| Molecular Formula | C15H20BrClN2O2 |
| Molecular Weight | 375.69 g/mol |
| Exact Mass | 374.04 |
| IUPAC Name | tert-butyl 3-[(3-bromo-4-chlorophenyl)methylamino]azetidine-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CC(NCc2ccc(Cl)c(Br)c2)C1 |
| InChI | InChI=1S/C15H20BrClN2O2/c1-15(2,3)21-14(20)19-8-11(9-19)18-7-10-4-5-13(17)12(16)6-10/h4-6,11,18H,7-9H2,1-3H3 |
| InChIKey | MFZLMUNLGDQTOY-UHFFFAOYSA-N |
| XLogP | 3.81 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.69 |
| LogP ≤ 5 | 3.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |