C16H23BrN2O2 — CID 107241926
tert-butyl 3-[(3-bromo-4-methylphenyl)methylamino]azetidine-1-carboxylate (PubChem CID 107241926) has the molecular formula C16H23BrN2O2 and a molecular weight of 355.28 g/mol. Its IUPAC name is tert-butyl 3-[(3-bromo-4-methylphenyl)methylamino]azetidine-1-carboxylate.
| Compound Name | tert-butyl 3-[(3-bromo-4-methylphenyl)methylamino]azetidine-1-carboxylate |
|---|---|
| PubChem CID | 107241926 |
| Molecular Formula | C16H23BrN2O2 |
| Molecular Weight | 355.28 g/mol |
| Exact Mass | 354.09 |
| IUPAC Name | tert-butyl 3-[(3-bromo-4-methylphenyl)methylamino]azetidine-1-carboxylate |
| SMILES | Cc1ccc(CNC2CN(C(=O)OC(C)(C)C)C2)cc1Br |
| InChI | InChI=1S/C16H23BrN2O2/c1-11-5-6-12(7-14(11)17)8-18-13-9-19(10-13)15(20)21-16(2,3)4/h5-7,13,18H,8-10H2,1-4H3 |
| InChIKey | RQUVMPNILFMJNF-UHFFFAOYSA-N |
| XLogP | 3.47 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.28 |
| LogP ≤ 5 | 3.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |