C15H22N2O4 — CID 103953629
tert-butyl 3-[(3,4-dihydroxyphenyl)methylamino]azetidine-1-carboxylate (PubChem CID 103953629) has the molecular formula C15H22N2O4 and a molecular weight of 294.35 g/mol. Its IUPAC name is tert-butyl 3-[(3,4-dihydroxyphenyl)methylamino]azetidine-1-carboxylate.
| Compound Name | tert-butyl 3-[(3,4-dihydroxyphenyl)methylamino]azetidine-1-carboxylate |
|---|---|
| PubChem CID | 103953629 |
| Molecular Formula | C15H22N2O4 |
| Molecular Weight | 294.35 g/mol |
| Exact Mass | 294.16 |
| IUPAC Name | tert-butyl 3-[(3,4-dihydroxyphenyl)methylamino]azetidine-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CC(NCc2ccc(O)c(O)c2)C1 |
| InChI | InChI=1S/C15H22N2O4/c1-15(2,3)21-14(20)17-8-11(9-17)16-7-10-4-5-12(18)13(19)6-10/h4-6,11,16,18-19H,7-9H2,1-3H3 |
| InChIKey | ZJQIZSLEJMJTCK-UHFFFAOYSA-N |
| XLogP | 1.81 |
| TPSA | 82.03 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.35 |
| LogP ≤ 5 | 1.81 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|