C15H22BrN3O2 — CID 134413630
tert-butyl 3-[(2-amino-4-bromophenyl)methylamino]azetidine-1-carboxylate (PubChem CID 134413630) has the molecular formula C15H22BrN3O2 and a molecular weight of 356.26 g/mol. Its IUPAC name is tert-butyl 3-[(2-amino-4-bromophenyl)methylamino]azetidine-1-carboxylate.
| Compound Name | tert-butyl 3-[(2-amino-4-bromophenyl)methylamino]azetidine-1-carboxylate |
|---|---|
| PubChem CID | 134413630 |
| Molecular Formula | C15H22BrN3O2 |
| Molecular Weight | 356.26 g/mol |
| Exact Mass | 355.09 |
| IUPAC Name | tert-butyl 3-[(2-amino-4-bromophenyl)methylamino]azetidine-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CC(NCc2ccc(Br)cc2N)C1 |
| InChI | InChI=1S/C15H22BrN3O2/c1-15(2,3)21-14(20)19-8-12(9-19)18-7-10-4-5-11(16)6-13(10)17/h4-6,12,18H,7-9,17H2,1-3H3 |
| InChIKey | ZWXUXTFTPAKHMJ-UHFFFAOYSA-N |
| XLogP | 2.74 |
| TPSA | 67.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.26 |
| LogP ≤ 5 | 2.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|