C15H20Cl2N2O3 — CID 103748570
tert-butyl 3-[(3,5-dichloro-2-hydroxyphenyl)methylamino]azetidine-1-carboxylate (PubChem CID 103748570) has the molecular formula C15H20Cl2N2O3 and a molecular weight of 347.24 g/mol. Its IUPAC name is tert-butyl 3-[(3,5-dichloro-2-hydroxyphenyl)methylamino]azetidine-1-carboxylate.
| Compound Name | tert-butyl 3-[(3,5-dichloro-2-hydroxyphenyl)methylamino]azetidine-1-carboxylate |
|---|---|
| PubChem CID | 103748570 |
| Molecular Formula | C15H20Cl2N2O3 |
| Molecular Weight | 347.24 g/mol |
| Exact Mass | 346.09 |
| IUPAC Name | tert-butyl 3-[(3,5-dichloro-2-hydroxyphenyl)methylamino]azetidine-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CC(NCc2cc(Cl)cc(Cl)c2O)C1 |
| InChI | InChI=1S/C15H20Cl2N2O3/c1-15(2,3)22-14(21)19-7-11(8-19)18-6-9-4-10(16)5-12(17)13(9)20/h4-5,11,18,20H,6-8H2,1-3H3 |
| InChIKey | SJMPLZRPHOVAQI-UHFFFAOYSA-N |
| XLogP | 3.41 |
| TPSA | 61.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.24 |
| LogP ≤ 5 | 3.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'} |
|---|