C17H22ClN3O2 — CID 107241823
tert-butyl 3-[(6-chloro-1H-indol-3-yl)methylamino]azetidine-1-carboxylate (PubChem CID 107241823) has the molecular formula C17H22ClN3O2 and a molecular weight of 335.84 g/mol. Its IUPAC name is tert-butyl 3-[(6-chloro-1H-indol-3-yl)methylamino]azetidine-1-carboxylate.
| Compound Name | tert-butyl 3-[(6-chloro-1H-indol-3-yl)methylamino]azetidine-1-carboxylate |
|---|---|
| PubChem CID | 107241823 |
| Molecular Formula | C17H22ClN3O2 |
| Molecular Weight | 335.84 g/mol |
| Exact Mass | 335.14 |
| IUPAC Name | tert-butyl 3-[(6-chloro-1H-indol-3-yl)methylamino]azetidine-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CC(NCc2c[nH]c3cc(Cl)ccc23)C1 |
| InChI | InChI=1S/C17H22ClN3O2/c1-17(2,3)23-16(22)21-9-13(10-21)19-7-11-8-20-15-6-12(18)4-5-14(11)15/h4-6,8,13,19-20H,7,9-10H2,1-3H3 |
| InChIKey | IJDZAQITVKBNBD-UHFFFAOYSA-N |
| XLogP | 3.53 |
| TPSA | 57.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.84 |
| LogP ≤ 5 | 3.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |