C16H21ClN2 — CID 78968600
N-[(6-chloro-1H-indol-3-yl)methyl]-4-methylcyclohexan-1-amine (PubChem CID 78968600) has the molecular formula C16H21ClN2 and a molecular weight of 276.81 g/mol. Its IUPAC name is N-[(6-chloro-1H-indol-3-yl)methyl]-4-methylcyclohexan-1-amine.
| Compound Name | N-[(6-chloro-1H-indol-3-yl)methyl]-4-methylcyclohexan-1-amine |
|---|---|
| PubChem CID | 78968600 |
| Molecular Formula | C16H21ClN2 |
| Molecular Weight | 276.81 g/mol |
| Exact Mass | 276.14 |
| IUPAC Name | N-[(6-chloro-1H-indol-3-yl)methyl]-4-methylcyclohexan-1-amine |
| SMILES | CC1CCC(NCc2c[nH]c3cc(Cl)ccc23)CC1 |
| InChI | InChI=1S/C16H21ClN2/c1-11-2-5-14(6-3-11)18-9-12-10-19-16-8-13(17)4-7-15(12)16/h4,7-8,10-11,14,18-19H,2-3,5-6,9H2,1H3 |
| InChIKey | IYZUOOCKLUYHRC-UHFFFAOYSA-N |
| XLogP | 4.49 |
| TPSA | 27.82 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.81 |
| LogP ≤ 5 | 4.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |