C12H12ClNO — CID 117177526
N-[(6-chloro-1-benzofuran-3-yl)methyl]cyclopropanamine (PubChem CID 117177526) has the molecular formula C12H12ClNO and a molecular weight of 221.69 g/mol. Its IUPAC name is N-[(6-chloro-1-benzofuran-3-yl)methyl]cyclopropanamine.
| Compound Name | N-[(6-chloro-1-benzofuran-3-yl)methyl]cyclopropanamine |
|---|---|
| PubChem CID | 117177526 |
| Molecular Formula | C12H12ClNO |
| Molecular Weight | 221.69 g/mol |
| Exact Mass | 221.06 |
| IUPAC Name | N-[(6-chloro-1-benzofuran-3-yl)methyl]cyclopropanamine |
| SMILES | Clc1ccc2c(CNC3CC3)coc2c1 |
| InChI | InChI=1S/C12H12ClNO/c13-9-1-4-11-8(6-14-10-2-3-10)7-15-12(11)5-9/h1,4-5,7,10,14H,2-3,6H2 |
| InChIKey | YMSXROJLDODLRN-UHFFFAOYSA-N |
| XLogP | 3.34 |
| TPSA | 25.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 221.69 |
| LogP ≤ 5 | 3.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |