C14H17Cl3N2O2 — CID 63425385
tert-butyl 3-(2,4,6-trichloroanilino)azetidine-1-carboxylate (PubChem CID 63425385) has the molecular formula C14H17Cl3N2O2 and a molecular weight of 351.66 g/mol. Its IUPAC name is tert-butyl 3-(2,4,6-trichloroanilino)azetidine-1-carboxylate.
| Compound Name | tert-butyl 3-(2,4,6-trichloroanilino)azetidine-1-carboxylate |
|---|---|
| PubChem CID | 63425385 |
| Molecular Formula | C14H17Cl3N2O2 |
| Molecular Weight | 351.66 g/mol |
| Exact Mass | 350.04 |
| IUPAC Name | tert-butyl 3-(2,4,6-trichloroanilino)azetidine-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CC(Nc2c(Cl)cc(Cl)cc2Cl)C1 |
| InChI | InChI=1S/C14H17Cl3N2O2/c1-14(2,3)21-13(20)19-6-9(7-19)18-12-10(16)4-8(15)5-11(12)17/h4-5,9,18H,6-7H2,1-3H3 |
| InChIKey | RPJBONRJYMCTPS-UHFFFAOYSA-N |
| XLogP | 4.68 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.66 |
| LogP ≤ 5 | 4.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |