C16H23BrN2O2 — CID 63449195
tert-butyl 3-(4-bromo-2,6-dimethylanilino)azetidine-1-carboxylate (PubChem CID 63449195) has the molecular formula C16H23BrN2O2 and a molecular weight of 355.28 g/mol. Its IUPAC name is tert-butyl 3-(4-bromo-2,6-dimethylanilino)azetidine-1-carboxylate.
| Compound Name | tert-butyl 3-(4-bromo-2,6-dimethylanilino)azetidine-1-carboxylate |
|---|---|
| PubChem CID | 63449195 |
| Molecular Formula | C16H23BrN2O2 |
| Molecular Weight | 355.28 g/mol |
| Exact Mass | 354.09 |
| IUPAC Name | tert-butyl 3-(4-bromo-2,6-dimethylanilino)azetidine-1-carboxylate |
| SMILES | Cc1cc(Br)cc(C)c1NC1CN(C(=O)OC(C)(C)C)C1 |
| InChI | InChI=1S/C16H23BrN2O2/c1-10-6-12(17)7-11(2)14(10)18-13-8-19(9-13)15(20)21-16(3,4)5/h6-7,13,18H,8-9H2,1-5H3 |
| InChIKey | UOZDYKLVMVVQQC-UHFFFAOYSA-N |
| XLogP | 4.10 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.28 |
| LogP ≤ 5 | 4.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |