C14H17BrF2N2O2 — CID 102852789
tert-butyl 3-(5-bromo-2,4-difluoroanilino)azetidine-1-carboxylate (PubChem CID 102852789) has the molecular formula C14H17BrF2N2O2 and a molecular weight of 363.20 g/mol. Its IUPAC name is tert-butyl 3-(5-bromo-2,4-difluoroanilino)azetidine-1-carboxylate.
| Compound Name | tert-butyl 3-(5-bromo-2,4-difluoroanilino)azetidine-1-carboxylate |
|---|---|
| PubChem CID | 102852789 |
| Molecular Formula | C14H17BrF2N2O2 |
| Molecular Weight | 363.20 g/mol |
| Exact Mass | 362.04 |
| IUPAC Name | tert-butyl 3-(5-bromo-2,4-difluoroanilino)azetidine-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CC(Nc2cc(Br)c(F)cc2F)C1 |
| InChI | InChI=1S/C14H17BrF2N2O2/c1-14(2,3)21-13(20)19-6-8(7-19)18-12-4-9(15)10(16)5-11(12)17/h4-5,8,18H,6-7H2,1-3H3 |
| InChIKey | GKJAXWVYGYCRPC-UHFFFAOYSA-N |
| XLogP | 3.76 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.20 |
| LogP ≤ 5 | 3.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|